C12H30Cl2N2O2S2 — CID 131886661
2-[2-(diethylamino)ethylsulfonylsulfanyl]-N,N-diethylethanamine;dihydrochloride (PubChem CID 131886661) has the molecular formula C12H30Cl2N2O2S2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylsulfonylsulfanyl]-N,N-diethylethanamine;dihydrochloride.
| Compound Name | 2-[2-(diethylamino)ethylsulfonylsulfanyl]-N,N-diethylethanamine;dihydrochloride |
|---|---|
| PubChem CID | 131886661 |
| Molecular Formula | C12H30Cl2N2O2S2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-[2-(diethylamino)ethylsulfonylsulfanyl]-N,N-diethylethanamine;dihydrochloride |
| SMILES | CCN(CC)CCSS(=O)(=O)CCN(CC)CC.Cl.Cl |
| InChI | InChI=1S/C12H28N2O2S2.2ClH/c1-5-13(6-2)9-11-17-18(15,16)12-10-14(7-3)8-4;;/h5-12H2,1-4H3;2*1H |
| InChIKey | CFRLUOTVAJFTKE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|