C13H20FN3O — CID 131891058
2-[4-[[(3-fluoro-2-pyridinyl)amino]methyl]piperidin-1-yl]ethanol (PubChem CID 131891058) has the molecular formula C13H20FN3O and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-[4-[[(3-fluoro-2-pyridinyl)amino]methyl]piperidin-1-yl]ethanol.
| Compound Name | 2-[4-[[(3-fluoro-2-pyridinyl)amino]methyl]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 131891058 |
| Molecular Formula | C13H20FN3O |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-[4-[[(3-fluoro-2-pyridinyl)amino]methyl]piperidin-1-yl]ethanol |
| SMILES | OCCN1CCC(CNc2ncccc2F)CC1 |
| InChI | InChI=1S/C13H20FN3O/c14-12-2-1-5-15-13(12)16-10-11-3-6-17(7-4-11)8-9-18/h1-2,5,11,18H,3-4,6-10H2,(H,15,16) |
| InChIKey | WIVFBORGROMTDT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |