C18H25N3O5 — CID 154914907
formic acid;2-[4-(isoquinolin-1-ylamino)piperidin-1-yl]ethanol (PubChem CID 154914907) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is formic acid;2-[4-(isoquinolin-1-ylamino)piperidin-1-yl]ethanol.
| Compound Name | formic acid;2-[4-(isoquinolin-1-ylamino)piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 154914907 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | formic acid;2-[4-(isoquinolin-1-ylamino)piperidin-1-yl]ethanol |
| SMILES | O=CO.O=CO.OCCN1CCC(Nc2nccc3ccccc23)CC1 |
| InChI | InChI=1S/C16H21N3O.2CH2O2/c20-12-11-19-9-6-14(7-10-19)18-16-15-4-2-1-3-13(15)5-8-17-16;2*2-1-3/h1-5,8,14,20H,6-7,9-12H2,(H,17,18);2*1H,(H,2,3) |
| InChIKey | MGXWHCPCDQBEKJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|