C30H46N4O7 — CID 131896590
(6S,12R)-12-[4-(2-hydroxypropan-2-yl)piperidine-1-carbonyl]-8-(2-methoxyethyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione (PubChem CID 131896590) has the molecular formula C30H46N4O7 and a molecular weight of 574.72 g/mol. Its IUPAC name is (6S,12R)-12-[4-(2-hydroxypropan-2-yl)piperidine-1-carbonyl]-8-(2-methoxyethyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione.
| Compound Name | (6S,12R)-12-[4-(2-hydroxypropan-2-yl)piperidine-1-carbonyl]-8-(2-methoxyethyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione |
|---|---|
| PubChem CID | 131896590 |
| Molecular Formula | C30H46N4O7 |
| Molecular Weight | 574.72 g/mol |
| Exact Mass | 574.34 |
| IUPAC Name | (6S,12R)-12-[4-(2-hydroxypropan-2-yl)piperidine-1-carbonyl]-8-(2-methoxyethyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione |
| SMILES | COCCN1CC(=O)N[C@@H](C(=O)N2CCC(C(C)(C)O)CC2)Cc2ccc(cc2)OCC(=O)N[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C30H46N4O7/c1-20(2)16-24-29(38)34(14-15-40-5)18-26(35)31-25(28(37)33-12-10-22(11-13-33)30(3,4)39)17-21-6-8-23(9-7-21)41-19-27(36)32-24/h6-9,20,22,24-25,39H,10-19H2,1-5H3,(H,31,35)(H,32,36)/t24-,25+/m0/s1 |
| InChIKey | FEUHKPXZFIHNTB-LOSJGSFVSA-N |
| XLogP | 1.12 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.72 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|