C28H42N4O7 — CID 131906141
(6S,12S)-12-[4-(hydroxymethyl)piperidine-1-carbonyl]-8-(2-methoxyethyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione (PubChem CID 131906141) has the molecular formula C28H42N4O7 and a molecular weight of 546.67 g/mol. Its IUPAC name is (6S,12S)-12-[4-(hydroxymethyl)piperidine-1-carbonyl]-8-(2-methoxyethyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione.
| Compound Name | (6S,12S)-12-[4-(hydroxymethyl)piperidine-1-carbonyl]-8-(2-methoxyethyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione |
|---|---|
| PubChem CID | 131906141 |
| Molecular Formula | C28H42N4O7 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | (6S,12S)-12-[4-(hydroxymethyl)piperidine-1-carbonyl]-8-(2-methoxyethyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione |
| SMILES | COCCN1CC(=O)N[C@H](C(=O)N2CCC(CO)CC2)Cc2ccc(cc2)OCC(=O)N[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C28H42N4O7/c1-19(2)14-23-28(37)32(12-13-38-3)16-25(34)29-24(27(36)31-10-8-21(17-33)9-11-31)15-20-4-6-22(7-5-20)39-18-26(35)30-23/h4-7,19,21,23-24,33H,8-18H2,1-3H3,(H,29,34)(H,30,35)/t23-,24-/m0/s1 |
| InChIKey | XUGWIQSEHSPFNO-ZEQRLZLVSA-N |
| XLogP | 0.34 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|