C30H41N7O6 — CID 131926424
(6S,12R)-8-(2-methoxyethyl)-6-(2-methylpropyl)-12-(4-pyrimidin-2-ylpiperazine-1-carbonyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione (PubChem CID 131926424) has the molecular formula C30H41N7O6 and a molecular weight of 595.70 g/mol. Its IUPAC name is (6S,12R)-8-(2-methoxyethyl)-6-(2-methylpropyl)-12-(4-pyrimidin-2-ylpiperazine-1-carbonyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione.
| Compound Name | (6S,12R)-8-(2-methoxyethyl)-6-(2-methylpropyl)-12-(4-pyrimidin-2-ylpiperazine-1-carbonyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione |
|---|---|
| PubChem CID | 131926424 |
| Molecular Formula | C30H41N7O6 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | (6S,12R)-8-(2-methoxyethyl)-6-(2-methylpropyl)-12-(4-pyrimidin-2-ylpiperazine-1-carbonyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione |
| SMILES | COCCN1CC(=O)N[C@@H](C(=O)N2CCN(c3ncccn3)CC2)Cc2ccc(cc2)OCC(=O)N[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C30H41N7O6/c1-21(2)17-24-29(41)37(15-16-42-3)19-26(38)33-25(18-22-5-7-23(8-6-22)43-20-27(39)34-24)28(40)35-11-13-36(14-12-35)30-31-9-4-10-32-30/h4-10,21,24-25H,11-20H2,1-3H3,(H,33,38)(H,34,39)/t24-,25+/m0/s1 |
| InChIKey | NXOIDVKCYYRELM-LOSJGSFVSA-N |
| XLogP | 0.25 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|