C27H41N5O6 — CID 131914656
(6S,12R)-8-(2-methoxyethyl)-12-(4-methylpiperazine-1-carbonyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione (PubChem CID 131914656) has the molecular formula C27H41N5O6 and a molecular weight of 531.65 g/mol. Its IUPAC name is (6S,12R)-8-(2-methoxyethyl)-12-(4-methylpiperazine-1-carbonyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione.
| Compound Name | (6S,12R)-8-(2-methoxyethyl)-12-(4-methylpiperazine-1-carbonyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione |
|---|---|
| PubChem CID | 131914656 |
| Molecular Formula | C27H41N5O6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | (6S,12R)-8-(2-methoxyethyl)-12-(4-methylpiperazine-1-carbonyl)-6-(2-methylpropyl)-2-oxa-5,8,11-triazabicyclo[12.2.2]octadeca-1(16),14,17-triene-4,7,10-trione |
| SMILES | COCCN1CC(=O)N[C@@H](C(=O)N2CCN(C)CC2)Cc2ccc(cc2)OCC(=O)N[C@@H](CC(C)C)C1=O |
| InChI | InChI=1S/C27H41N5O6/c1-19(2)15-22-27(36)32(13-14-37-4)17-24(33)28-23(26(35)31-11-9-30(3)10-12-31)16-20-5-7-21(8-6-20)38-18-25(34)29-22/h5-8,19,22-23H,9-18H2,1-4H3,(H,28,33)(H,29,34)/t22-,23+/m0/s1 |
| InChIKey | SRAWGOBCDVWLRW-XZOQPEGZSA-N |
| XLogP | -0.11 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|