C21H28N4OS — CID 131897360
1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N-methylethanamine (PubChem CID 131897360) has the molecular formula C21H28N4OS and a molecular weight of 384.55 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N-methylethanamine.
| Compound Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 131897360 |
| Molecular Formula | C21H28N4OS |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)-N-[[3-(3-imidazol-1-ylpropoxy)phenyl]methyl]-N-methylethanamine |
| SMILES | Cc1nc(C(C)N(C)Cc2cccc(OCCCn3ccnc3)c2)c(C)s1 |
| InChI | InChI=1S/C21H28N4OS/c1-16(21-17(2)27-18(3)23-21)24(4)14-19-7-5-8-20(13-19)26-12-6-10-25-11-9-22-15-25/h5,7-9,11,13,15-16H,6,10,12,14H2,1-4H3 |
| InChIKey | PQDGTEFJAZZMBW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|