C17H16FN3O4 — CID 131899563
N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 131899563) has the molecular formula C17H16FN3O4 and a molecular weight of 345.33 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 131899563 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[[5-(4-fluorophenyl)furan-2-yl]methyl]-2-(3-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CN1CC(=O)N(CC(=O)NCc2ccc(-c3ccc(F)cc3)o2)C1=O |
| InChI | InChI=1S/C17H16FN3O4/c1-20-10-16(23)21(17(20)24)9-15(22)19-8-13-6-7-14(25-13)11-2-4-12(18)5-3-11/h2-7H,8-10H2,1H3,(H,19,22) |
| InChIKey | RPYWMRUJQKNHTO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|