C21H33N3 — CID 131904950
1-(2,3-dihydro-1H-inden-5-yl)-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]piperidin-4-amine (PubChem CID 131904950) has the molecular formula C21H33N3 and a molecular weight of 327.52 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]piperidin-4-amine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 131904950 |
| Molecular Formula | C21H33N3 |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.27 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-N-[(1,3-dimethylpyrrolidin-3-yl)methyl]piperidin-4-amine |
| SMILES | CN1CCC(C)(CNC2CCN(c3ccc4c(c3)CCC4)CC2)C1 |
| InChI | InChI=1S/C21H33N3/c1-21(10-13-23(2)16-21)15-22-19-8-11-24(12-9-19)20-7-6-17-4-3-5-18(17)14-20/h6-7,14,19,22H,3-5,8-13,15-16H2,1-2H3 |
| InChIKey | GGMWVZRXAWKXSF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|