C15H18N4O3 — CID 131915645
N-[3-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,2,4-triazol-3-yl]propyl]acetamide (PubChem CID 131915645) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[3-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,2,4-triazol-3-yl]propyl]acetamide.
| Compound Name | N-[3-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,2,4-triazol-3-yl]propyl]acetamide |
|---|---|
| PubChem CID | 131915645 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[3-[2-(1,3-benzodioxol-5-yl)-5-methyl-1,2,4-triazol-3-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1nc(C)nn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H18N4O3/c1-10-17-15(4-3-7-16-11(2)20)19(18-10)12-5-6-13-14(8-12)22-9-21-13/h5-6,8H,3-4,7,9H2,1-2H3,(H,16,20) |
| InChIKey | DBXKOVHVBBLXSS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|