C16H20ClN3O4 — CID 131920491
N-(3-chloro-2-propoxyphenyl)-2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetamide (PubChem CID 131920491) has the molecular formula C16H20ClN3O4 and a molecular weight of 353.81 g/mol. Its IUPAC name is N-(3-chloro-2-propoxyphenyl)-2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetamide.
| Compound Name | N-(3-chloro-2-propoxyphenyl)-2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 131920491 |
| Molecular Formula | C16H20ClN3O4 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-(3-chloro-2-propoxyphenyl)-2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)acetamide |
| SMILES | CCCOc1c(Cl)cccc1NC(=O)CC1C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C16H20ClN3O4/c1-4-8-24-14-10(17)6-5-7-11(14)18-13(21)9-12-15(22)20(3)16(23)19(12)2/h5-7,12H,4,8-9H2,1-3H3,(H,18,21) |
| InChIKey | KEXGJKQOCAKHBD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|