C19H22N4O2S — CID 131930381
N-[[1-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]methyl]pyridazine-4-carboxamide (PubChem CID 131930381) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is N-[[1-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]methyl]pyridazine-4-carboxamide.
| Compound Name | N-[[1-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]methyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 131930381 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[[1-[[5-(3-hydroxyprop-1-ynyl)thiophen-2-yl]methyl]piperidin-3-yl]methyl]pyridazine-4-carboxamide |
| SMILES | O=C(NCC1CCCN(Cc2ccc(C#CCO)s2)C1)c1ccnnc1 |
| InChI | InChI=1S/C19H22N4O2S/c24-10-2-4-17-5-6-18(26-17)14-23-9-1-3-15(13-23)11-20-19(25)16-7-8-21-22-12-16/h5-8,12,15,24H,1,3,9-11,13-14H2,(H,20,25) |
| InChIKey | BVWKDLCMNUXPNS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|