C16H20N4O2 — CID 131932133
N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-2-(oxan-3-yl)acetamide (PubChem CID 131932133) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-2-(oxan-3-yl)acetamide.
| Compound Name | N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-2-(oxan-3-yl)acetamide |
|---|---|
| PubChem CID | 131932133 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[3-(5-methyl-1H-1,2,4-triazol-3-yl)phenyl]-2-(oxan-3-yl)acetamide |
| SMILES | Cc1nc(-c2cccc(NC(=O)CC3CCCOC3)c2)n[nH]1 |
| InChI | InChI=1S/C16H20N4O2/c1-11-17-16(20-19-11)13-5-2-6-14(9-13)18-15(21)8-12-4-3-7-22-10-12/h2,5-6,9,12H,3-4,7-8,10H2,1H3,(H,18,21)(H,17,19,20) |
| InChIKey | CHADCILXKIHPSU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |