C27H33N3O3 — CID 131934343
1'-(2-pyrrolidin-3-ylacetyl)spiro[2-oxa-10-azatricyclo[12.3.1.13,7]nonadeca-1(17),3,5,7(19),14(18),15-hexaene-12,4'-piperidine]-11-one (PubChem CID 131934343) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 1'-(2-pyrrolidin-3-ylacetyl)spiro[2-oxa-10-azatricyclo[12.3.1.13,7]nonadeca-1(17),3,5,7(19),14(18),15-hexaene-12,4'-piperidine]-11-one.
| Compound Name | 1'-(2-pyrrolidin-3-ylacetyl)spiro[2-oxa-10-azatricyclo[12.3.1.13,7]nonadeca-1(17),3,5,7(19),14(18),15-hexaene-12,4'-piperidine]-11-one |
|---|---|
| PubChem CID | 131934343 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 1'-(2-pyrrolidin-3-ylacetyl)spiro[2-oxa-10-azatricyclo[12.3.1.13,7]nonadeca-1(17),3,5,7(19),14(18),15-hexaene-12,4'-piperidine]-11-one |
| SMILES | O=C(CC1CCNC1)N1CCC2(CC1)Cc1cccc(c1)Oc1cccc(c1)CCNC2=O |
| InChI | InChI=1S/C27H33N3O3/c31-25(17-22-7-11-28-19-22)30-13-9-27(10-14-30)18-21-4-2-6-24(16-21)33-23-5-1-3-20(15-23)8-12-29-26(27)32/h1-6,15-16,22,28H,7-14,17-19H2,(H,29,32) |
| InChIKey | RAQRQGPCEPRQHM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |