C21H31N3 — CID 131939280
1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-(pyridin-3-ylmethyl)-1,4-diazepane (PubChem CID 131939280) has the molecular formula C21H31N3 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-(pyridin-3-ylmethyl)-1,4-diazepane.
| Compound Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-(pyridin-3-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 131939280 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | 1-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-4-(pyridin-3-ylmethyl)-1,4-diazepane |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCCN(Cc4cccnc4)CC3)[C@@H]1C2 |
| InChI | InChI=1S/C21H31N3/c1-21(2)19-7-6-18(20(21)13-19)16-24-10-4-9-23(11-12-24)15-17-5-3-8-22-14-17/h3,5-6,8,14,19-20H,4,7,9-13,15-16H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | MFELHUOOYXSNIQ-PMACEKPBSA-N |
| XLogP | 3.58 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|