C11H14BrN5O2S — CID 131961078
N-(4-bromo-3-methylphenyl)-N-[(2-methyltetrazol-5-yl)methyl]methanesulfonamide (PubChem CID 131961078) has the molecular formula C11H14BrN5O2S and a molecular weight of 360.24 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-N-[(2-methyltetrazol-5-yl)methyl]methanesulfonamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-N-[(2-methyltetrazol-5-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 131961078 |
| Molecular Formula | C11H14BrN5O2S |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-N-[(2-methyltetrazol-5-yl)methyl]methanesulfonamide |
| SMILES | Cc1cc(N(Cc2nnn(C)n2)S(C)(=O)=O)ccc1Br |
| InChI | InChI=1S/C11H14BrN5O2S/c1-8-6-9(4-5-10(8)12)17(20(3,18)19)7-11-13-15-16(2)14-11/h4-6H,7H2,1-3H3 |
| InChIKey | VCOSWXJCWVESGR-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |