C14H22BrNO3S — CID 75418730
N-(4-bromo-3-methylphenyl)-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]methanesulfonamide (PubChem CID 75418730) has the molecular formula C14H22BrNO3S and a molecular weight of 364.31 g/mol. Its IUPAC name is N-(4-bromo-3-methylphenyl)-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]methanesulfonamide.
| Compound Name | N-(4-bromo-3-methylphenyl)-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 75418730 |
| Molecular Formula | C14H22BrNO3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-(4-bromo-3-methylphenyl)-N-[2-[(2-methylpropan-2-yl)oxy]ethyl]methanesulfonamide |
| SMILES | Cc1cc(N(CCOC(C)(C)C)S(C)(=O)=O)ccc1Br |
| InChI | InChI=1S/C14H22BrNO3S/c1-11-10-12(6-7-13(11)15)16(20(5,17)18)8-9-19-14(2,3)4/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | OLIMIJLKDGMGAS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |