C16H20N2O3S — CID 131962086
6-(3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-ylmethyl)-4H-1,4-benzoxazin-3-one (PubChem CID 131962086) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 6-(3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-ylmethyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-(3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-ylmethyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 131962086 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 6-(3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazin-1-ylmethyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2ccc(CN3CCSC4COCCC43)cc2N1 |
| InChI | InChI=1S/C16H20N2O3S/c19-16-10-21-14-2-1-11(7-12(14)17-16)8-18-4-6-22-15-9-20-5-3-13(15)18/h1-2,7,13,15H,3-6,8-10H2,(H,17,19) |
| InChIKey | HZMWRHCKSIQFQQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |