C17H15ClN2O3S2 — CID 131962937
4-(5-chlorothiophen-2-yl)-N-[3-(methylsulfonylmethyl)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 131962937) has the molecular formula C17H15ClN2O3S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-N-[3-(methylsulfonylmethyl)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-N-[3-(methylsulfonylmethyl)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 131962937 |
| Molecular Formula | C17H15ClN2O3S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-N-[3-(methylsulfonylmethyl)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CS(=O)(=O)Cc1cccc(NC(=O)c2c[nH]cc2-c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C17H15ClN2O3S2/c1-25(22,23)10-11-3-2-4-12(7-11)20-17(21)14-9-19-8-13(14)15-5-6-16(18)24-15/h2-9,19H,10H2,1H3,(H,20,21) |
| InChIKey | LBVJXRWDXAIJTA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |