C20H14N2O2 — CID 131965348
(Z)-3-phenyl-2-(1H-pyrido[3,4-b]indol-1-yl)prop-2-enoic acid (PubChem CID 131965348) has the molecular formula C20H14N2O2 and a molecular weight of 314.34 g/mol. Its IUPAC name is (Z)-3-phenyl-2-(1H-pyrido[3,4-b]indol-1-yl)prop-2-enoic acid.
| Compound Name | (Z)-3-phenyl-2-(1H-pyrido[3,4-b]indol-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 131965348 |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (Z)-3-phenyl-2-(1H-pyrido[3,4-b]indol-1-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1)C1N=CC=C2C1=Nc1ccccc12 |
| InChI | InChI=1S/C20H14N2O2/c23-20(24)16(12-13-6-2-1-3-7-13)18-19-15(10-11-21-18)14-8-4-5-9-17(14)22-19/h1-12,18H,(H,23,24)/b16-12- |
| InChIKey | KEGNVJQFAJHAMD-VBKFSLOCSA-N |
| XLogP | 3.78 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|