C13H10N2O2 — CID 150065016
1-methyl-1H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 150065016) has the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-methyl-1H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-methyl-1H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 150065016 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-methyl-1H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | CC1N=C(C(=O)O)C=C2C1=Nc1ccccc12 |
| InChI | InChI=1S/C13H10N2O2/c1-7-12-9(6-11(14-7)13(16)17)8-4-2-3-5-10(8)15-12/h2-7H,1H3,(H,16,17) |
| InChIKey | DOCCYSMTNMBXOT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 62.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |