About 1-methyl-1H-carbazole
1-methyl-1H-carbazole (PubChem CID 154092171) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 1-methyl-1H-carbazole.
Molecular Properties
| Compound Name | 1-methyl-1H-carbazole |
| PubChem CID | 154092171 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 1-methyl-1H-carbazole |
| SMILES | CC1C=CC=C2C1=Nc1ccccc12 |
| InChI | InChI=1S/C13H11N/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11/h2-9H,1H3 |
| InChIKey | KJBUBFXXARADDF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-1H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1H-carbazole?
The IUPAC name of 1-methyl-1H-carbazole (CID 154092171) is 1-methyl-1H-carbazole.
What is the SMILES notation for 1-methyl-1H-carbazole?
The canonical SMILES for 1-methyl-1H-carbazole is CC1C=CC=C2C1=Nc1ccccc12.
What is the InChIKey of 1-methyl-1H-carbazole?
The InChIKey is KJBUBFXXARADDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-9-5-4-7-11-10-6-2-3-8-12(10)14-13(9)11/h2-9H,1H3.
What are the key properties of 1-methyl-1H-carbazole?
1-methyl-1H-carbazole has a molecular weight of 181.24 g/mol, XLogP of 3.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1H-carbazole is sourced from PubChem (CID 154092171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).