C11H14S2 — CID 131965894
5-ethyl-6-propan-2-ylthieno[3,2-b]thiophene (PubChem CID 131965894) has the molecular formula C11H14S2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 5-ethyl-6-propan-2-ylthieno[3,2-b]thiophene.
| Compound Name | 5-ethyl-6-propan-2-ylthieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 131965894 |
| Molecular Formula | C11H14S2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 5-ethyl-6-propan-2-ylthieno[3,2-b]thiophene |
| SMILES | CCc1sc2ccsc2c1C(C)C |
| InChI | InChI=1S/C11H14S2/c1-4-8-10(7(2)3)11-9(13-8)5-6-12-11/h5-7H,4H2,1-3H3 |
| InChIKey | OHKPMIIZZUSJAO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |