C6H2F2S2 — CID 118537059
5,6-difluorothieno[3,2-b]thiophene (PubChem CID 118537059) has the molecular formula C6H2F2S2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 5,6-difluorothieno[3,2-b]thiophene.
| Compound Name | 5,6-difluorothieno[3,2-b]thiophene |
|---|---|
| PubChem CID | 118537059 |
| Molecular Formula | C6H2F2S2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 175.96 |
| IUPAC Name | 5,6-difluorothieno[3,2-b]thiophene |
| SMILES | Fc1sc2ccsc2c1F |
| InChI | InChI=1S/C6H2F2S2/c7-4-5-3(1-2-9-5)10-6(4)8/h1-2H |
| InChIKey | JZJBREKWIHUCIE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |