C10H19N — CID 131967071
2,3-dimethyl-5-prop-1-en-2-ylcyclopentan-1-amine (PubChem CID 131967071) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is 2,3-dimethyl-5-prop-1-en-2-ylcyclopentan-1-amine.
| Compound Name | 2,3-dimethyl-5-prop-1-en-2-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 131967071 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 2,3-dimethyl-5-prop-1-en-2-ylcyclopentan-1-amine |
| SMILES | C=C(C)C1CC(C)C(C)C1N |
| InChI | InChI=1S/C10H19N/c1-6(2)9-5-7(3)8(4)10(9)11/h7-10H,1,5,11H2,2-4H3 |
| InChIKey | DEKNYJZPVBMGBP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|