C8H12O3S — CID 131968527
2-[5-(2-hydroxyethyl)thiophen-2-yl]ethane-1,1-diol (PubChem CID 131968527) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-[5-(2-hydroxyethyl)thiophen-2-yl]ethane-1,1-diol.
| Compound Name | 2-[5-(2-hydroxyethyl)thiophen-2-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 131968527 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | 2-[5-(2-hydroxyethyl)thiophen-2-yl]ethane-1,1-diol |
| SMILES | OCCc1ccc(CC(O)O)s1 |
| InChI | InChI=1S/C8H12O3S/c9-4-3-6-1-2-7(12-6)5-8(10)11/h1-2,8-11H,3-5H2 |
| InChIKey | KCQZPUDIYONPFI-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|