C10H16N2O3S — CID 131968730
S-methyl 1-(2-formamidopropanoyl)pyrrolidine-2-carbothioate (PubChem CID 131968730) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is S-methyl 1-(2-formamidopropanoyl)pyrrolidine-2-carbothioate.
| Compound Name | S-methyl 1-(2-formamidopropanoyl)pyrrolidine-2-carbothioate |
|---|---|
| PubChem CID | 131968730 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | S-methyl 1-(2-formamidopropanoyl)pyrrolidine-2-carbothioate |
| SMILES | CSC(=O)C1CCCN1C(=O)C(C)NC=O |
| InChI | InChI=1S/C10H16N2O3S/c1-7(11-6-13)9(14)12-5-3-4-8(12)10(15)16-2/h6-8H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | GKGXHFPEYHCBMY-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|