C28H27N3O3 — CID 131969032
2-amino-8-(4-formylphenyl)-N-phenylmethoxy-N-propyl-3H-1-benzazepine-4-carboxamide (PubChem CID 131969032) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 2-amino-8-(4-formylphenyl)-N-phenylmethoxy-N-propyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-8-(4-formylphenyl)-N-phenylmethoxy-N-propyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 131969032 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 2-amino-8-(4-formylphenyl)-N-phenylmethoxy-N-propyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(OCc1ccccc1)C(=O)C1=Cc2ccc(-c3ccc(C=O)cc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C28H27N3O3/c1-2-14-31(34-19-21-6-4-3-5-7-21)28(33)25-15-24-13-12-23(16-26(24)30-27(29)17-25)22-10-8-20(18-32)9-11-22/h3-13,15-16,18H,2,14,17,19H2,1H3,(H2,29,30) |
| InChIKey | AJFLUULWLHFOAM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|