C23H29N5O3 — CID 167207475
2-amino-N-(2-aminoethoxy)-8-[anilino(hydroxy)methyl]-N-propyl-3H-1-benzazepine-4-carboxamide (PubChem CID 167207475) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-amino-N-(2-aminoethoxy)-8-[anilino(hydroxy)methyl]-N-propyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-N-(2-aminoethoxy)-8-[anilino(hydroxy)methyl]-N-propyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 167207475 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-amino-N-(2-aminoethoxy)-8-[anilino(hydroxy)methyl]-N-propyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(OCCN)C(=O)C1=Cc2ccc(C(O)Nc3ccccc3)cc2N=C(N)C1 |
| InChI | InChI=1S/C23H29N5O3/c1-2-11-28(31-12-10-24)23(30)18-13-16-8-9-17(14-20(16)27-21(25)15-18)22(29)26-19-6-4-3-5-7-19/h3-9,13-14,22,26,29H,2,10-12,15,24H2,1H3,(H2,25,27) |
| InChIKey | PWPKHYSMXYMVSW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 126.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|