C26H29N5O6 — CID 176640047
2-amino-8-(morpholine-4-carbonyl)-N-[(4-nitrophenyl)methoxy]-N-propyl-3H-1-benzazepine-4-carboxamide (PubChem CID 176640047) has the molecular formula C26H29N5O6 and a molecular weight of 507.55 g/mol. Its IUPAC name is 2-amino-8-(morpholine-4-carbonyl)-N-[(4-nitrophenyl)methoxy]-N-propyl-3H-1-benzazepine-4-carboxamide.
| Compound Name | 2-amino-8-(morpholine-4-carbonyl)-N-[(4-nitrophenyl)methoxy]-N-propyl-3H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 176640047 |
| Molecular Formula | C26H29N5O6 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 2-amino-8-(morpholine-4-carbonyl)-N-[(4-nitrophenyl)methoxy]-N-propyl-3H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(OCc1ccc([N+](=O)[O-])cc1)C(=O)C1=Cc2ccc(C(=O)N3CCOCC3)cc2N=C(N)C1 |
| InChI | InChI=1S/C26H29N5O6/c1-2-9-30(37-17-18-3-7-22(8-4-18)31(34)35)26(33)21-14-19-5-6-20(15-23(19)28-24(27)16-21)25(32)29-10-12-36-13-11-29/h3-8,14-15H,2,9-13,16-17H2,1H3,(H2,27,28) |
| InChIKey | BWCQYUXGLYIHJM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 140.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|