C9H13Br3 — CID 131969876
(2E,6Z)-2,3,7-tribromonona-2,6-diene (PubChem CID 131969876) has the molecular formula C9H13Br3 and a molecular weight of 360.92 g/mol. Its IUPAC name is (2E,6Z)-2,3,7-tribromonona-2,6-diene.
| Compound Name | (2E,6Z)-2,3,7-tribromonona-2,6-diene |
|---|---|
| PubChem CID | 131969876 |
| Molecular Formula | C9H13Br3 |
| Molecular Weight | 360.92 g/mol |
| Exact Mass | 357.86 |
| IUPAC Name | (2E,6Z)-2,3,7-tribromonona-2,6-diene |
| SMILES | CC/C(Br)=C/CC/C(Br)=C(/C)Br |
| InChI | InChI=1S/C9H13Br3/c1-3-8(11)5-4-6-9(12)7(2)10/h5H,3-4,6H2,1-2H3/b8-5-,9-7+ |
| InChIKey | APVPANDAZYOIBY-ANVCMGODSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.92 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |