C5H11BrN2 — CID 131978464
(E)-1-bromo-N,N',N'-trimethylethene-1,2-diamine (PubChem CID 131978464) has the molecular formula C5H11BrN2 and a molecular weight of 179.06 g/mol. Its IUPAC name is (E)-1-bromo-N,N',N'-trimethylethene-1,2-diamine.
| Compound Name | (E)-1-bromo-N,N',N'-trimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 131978464 |
| Molecular Formula | C5H11BrN2 |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | (E)-1-bromo-N,N',N'-trimethylethene-1,2-diamine |
| SMILES | CN/C(Br)=C\N(C)C |
| InChI | InChI=1S/C5H11BrN2/c1-7-5(6)4-8(2)3/h4,7H,1-3H3/b5-4- |
| InChIKey | IXSZLJATWWHZHA-PLNGDYQASA-N |
| XLogP | 0.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|