C10H14O3 — CID 131983355
8-ethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 131983355) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 8-ethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | 8-ethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 131983355 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 8-ethyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | CCC1CC2CC1C1OC(=O)OC21 |
| InChI | InChI=1S/C10H14O3/c1-2-5-3-6-4-7(5)9-8(6)12-10(11)13-9/h5-9H,2-4H2,1H3 |
| InChIKey | SATMHEBKNYULBN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |