About 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one
10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 89259422) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one.
Analyze 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one?
The IUPAC name of 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one (CID 89259422) is 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one.
What is the SMILES notation for 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one?
The canonical SMILES for 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one is CC1C2CCC1C1OC(=O)OC21.
What is the InChIKey of 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one?
The InChIKey is COCKFIHNBYYTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-4-5-2-3-6(4)8-7(5)11-9(10)12-8/h4-8H,2-3H2,1H3.
What are the key properties of 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one?
10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one has a molecular weight of 168.19 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-3,5-dioxatricyclo[5.2.1.02,6]decan-4-one is sourced from PubChem (CID 89259422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).