About 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane
3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane (PubChem CID 91534605) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane.
Analyze 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane?
The IUPAC name of 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane (CID 91534605) is 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane.
What is the SMILES notation for 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane?
The canonical SMILES for 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane is CC(C)C.O=C1OC2C3CCC(C3)C2O1.
What is the InChIKey of 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane?
The InChIKey is SCMHPKLYABLESU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3.C4H10/c9-8-10-6-4-1-2-5(3-4)7(6)11-8;1-4(2)3/h4-7H,1-3H2;4H,1-3H3.
What are the key properties of 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane?
3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane has a molecular weight of 212.29 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dioxatricyclo[5.2.1.02,6]decan-4-one;2-methylpropane is sourced from PubChem (CID 91534605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).