C12H9F5 — CID 131983447
1,2,3,4,5-pentafluoro-6-(3-methylpent-1-ynyl)benzene (PubChem CID 131983447) has the molecular formula C12H9F5 and a molecular weight of 248.19 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(3-methylpent-1-ynyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(3-methylpent-1-ynyl)benzene |
|---|---|
| PubChem CID | 131983447 |
| Molecular Formula | C12H9F5 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(3-methylpent-1-ynyl)benzene |
| SMILES | CCC(C)C#Cc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H9F5/c1-3-6(2)4-5-7-8(13)10(15)12(17)11(16)9(7)14/h6H,3H2,1-2H3 |
| InChIKey | HUXIXSONLXOOPR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|