C15H9FN2OS — CID 131985823
2-fluoro-4-(6-methoxy-1,2-benzothiazol-7-yl)benzonitrile (PubChem CID 131985823) has the molecular formula C15H9FN2OS and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-fluoro-4-(6-methoxy-1,2-benzothiazol-7-yl)benzonitrile.
| Compound Name | 2-fluoro-4-(6-methoxy-1,2-benzothiazol-7-yl)benzonitrile |
|---|---|
| PubChem CID | 131985823 |
| Molecular Formula | C15H9FN2OS |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 2-fluoro-4-(6-methoxy-1,2-benzothiazol-7-yl)benzonitrile |
| SMILES | COc1ccc2cnsc2c1-c1ccc(C#N)c(F)c1 |
| InChI | InChI=1S/C15H9FN2OS/c1-19-13-5-4-11-8-18-20-15(11)14(13)9-2-3-10(7-17)12(16)6-9/h2-6,8H,1H3 |
| InChIKey | YSZHNXPUUQOWJV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |