About 1-pentyl-4H-quinoline
1-pentyl-4H-quinoline (PubChem CID 131986678) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-pentyl-4H-quinoline.
Molecular Properties
| Compound Name | 1-pentyl-4H-quinoline |
| PubChem CID | 131986678 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-pentyl-4H-quinoline |
| SMILES | CCCCCN1C=CCc2ccccc21 |
| InChI | InChI=1S/C14H19N/c1-2-3-6-11-15-12-7-9-13-8-4-5-10-14(13)15/h4-5,7-8,10,12H,2-3,6,9,11H2,1H3 |
| InChIKey | PBTKQVSHAMBMKB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentyl-4H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentyl-4H-quinoline?
The IUPAC name of 1-pentyl-4H-quinoline (CID 131986678) is 1-pentyl-4H-quinoline.
What is the SMILES notation for 1-pentyl-4H-quinoline?
The canonical SMILES for 1-pentyl-4H-quinoline is CCCCCN1C=CCc2ccccc21.
What is the InChIKey of 1-pentyl-4H-quinoline?
The InChIKey is PBTKQVSHAMBMKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-2-3-6-11-15-12-7-9-13-8-4-5-10-14(13)15/h4-5,7-8,10,12H,2-3,6,9,11H2,1H3.
What are the key properties of 1-pentyl-4H-quinoline?
1-pentyl-4H-quinoline has a molecular weight of 201.31 g/mol, XLogP of 3.75, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentyl-4H-quinoline is sourced from PubChem (CID 131986678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).