C18H12N2O — CID 13205314
5,7-diphenylfuro[3,4-d]pyridazine (PubChem CID 13205314) has the molecular formula C18H12N2O and a molecular weight of 272.31 g/mol. Its IUPAC name is 5,7-diphenylfuro[3,4-d]pyridazine.
| Compound Name | 5,7-diphenylfuro[3,4-d]pyridazine |
|---|---|
| PubChem CID | 13205314 |
| Molecular Formula | C18H12N2O |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 5,7-diphenylfuro[3,4-d]pyridazine |
| SMILES | c1ccc(-c2oc(-c3ccccc3)c3cnncc23)cc1 |
| InChI | InChI=1S/C18H12N2O/c1-3-7-13(8-4-1)17-15-11-19-20-12-16(15)18(21-17)14-9-5-2-6-10-14/h1-12H |
| InChIKey | YUYIQBFXDIZEAI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |