C24H32ClN3O5 — CID 13206297
[(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] (2S)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]propanoate (PubChem CID 13206297) has the molecular formula C24H32ClN3O5 and a molecular weight of 477.99 g/mol. Its IUPAC name is [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] (2S)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]propanoate.
| Compound Name | [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] (2S)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]propanoate |
|---|---|
| PubChem CID | 13206297 |
| Molecular Formula | C24H32ClN3O5 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | [(8R,9S,13S,14S,17S)-17-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] (2S)-2-[[2-chloroethyl(nitroso)carbamoyl]amino]propanoate |
| SMILES | C[C@H](NC(=O)N(CCCl)N=O)C(=O)Oc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C24H32ClN3O5/c1-14(26-23(31)28(27-32)12-11-25)22(30)33-16-4-6-17-15(13-16)3-5-19-18(17)9-10-24(2)20(19)7-8-21(24)29/h4,6,13-14,18-21,29H,3,5,7-12H2,1-2H3,(H,26,31)/t14-,18+,19+,20-,21-,24-/m0/s1 |
| InChIKey | VCHIMDQFARCAGF-RRSQKSOMSA-N |
| XLogP | 4.13 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|