C4H2F6N2O2 — CID 13213073
2,2,2-trifluoro-1-[3-(trifluoromethyl)diazirin-3-yl]ethane-1,1-diol (PubChem CID 13213073) has the molecular formula C4H2F6N2O2 and a molecular weight of 224.06 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[3-(trifluoromethyl)diazirin-3-yl]ethane-1,1-diol.
| Compound Name | 2,2,2-trifluoro-1-[3-(trifluoromethyl)diazirin-3-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 13213073 |
| Molecular Formula | C4H2F6N2O2 |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 2,2,2-trifluoro-1-[3-(trifluoromethyl)diazirin-3-yl]ethane-1,1-diol |
| SMILES | OC(O)(C(F)(F)F)C1(C(F)(F)F)N=N1 |
| InChI | InChI=1S/C4H2F6N2O2/c5-3(6,7)1(11-12-1)2(13,14)4(8,9)10/h13-14H |
| InChIKey | FLGLZLBGJMMSCP-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|