C14H18N2O2S — CID 132270559
4-Ethyl-3,5-dimethyl-1-(4-methylphenyl)sulfonylpyrazole (PubChem CID 132270559) has the molecular formula C14H18N2O2S and a molecular weight of 278.37 g/mol. Its IUPAC name is 4-ethyl-3,5-dimethyl-1-(4-methylphenyl)sulfonylpyrazole.
| Compound Name | 4-Ethyl-3,5-dimethyl-1-(4-methylphenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 132270559 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-ethyl-3,5-dimethyl-1-(4-methylphenyl)sulfonylpyrazole |
| SMILES | CCC1=C(N(N=C1C)S(=O)(=O)C2=CC=C(C=C2)C)C |
| InChI | InChI=1S/C14H18N2O2S/c1-5-14-11(3)15-16(12(14)4)19(17,18)13-8-6-10(2)7-9-13/h6-9H,5H2,1-4H3 |
| InChIKey | QJPSWHGBIRSRSK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | 396 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |