C21H18N6O6S2 — CID 13228438
7-[[(2E)-2-(2-amino-1,3-oxazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(thieno[2,3-b]pyridin-7-ium-7-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 13228438) has the molecular formula C21H18N6O6S2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 7-[[(2E)-2-(2-amino-1,3-oxazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(thieno[2,3-b]pyridin-7-ium-7-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 7-[[(2E)-2-(2-amino-1,3-oxazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(thieno[2,3-b]pyridin-7-ium-7-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 13228438 |
| Molecular Formula | C21H18N6O6S2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 7-[[(2E)-2-(2-amino-1,3-oxazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(thieno[2,3-b]pyridin-7-ium-7-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(/C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3cccc4ccsc43)CSC12)c1coc(N)n1 |
| InChI | InChI=1S/C21H18N6O6S2/c1-32-25-13(12-8-33-21(22)23-12)16(28)24-14-17(29)27-15(20(30)31)11(9-35-19(14)27)7-26-5-2-3-10-4-6-34-18(10)26/h2-6,8,14,19H,7,9H2,1H3,(H3-,22,23,24,28,30,31)/b25-13+ |
| InChIKey | FQPHYEAUNSHASW-DHRITJCHSA-N |
| XLogP | -0.79 |
| TPSA | 167.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|