C22H19N7O6S — CID 88733816
(6S)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(quinolin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88733816) has the molecular formula C22H19N7O6S and a molecular weight of 509.50 g/mol. Its IUPAC name is (6S)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(quinolin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6S)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(quinolin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88733816 |
| Molecular Formula | C22H19N7O6S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | (6S)-7-[[2-(5-amino-1,2,4-oxadiazol-3-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-(quinolin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3cccc4ccccc43)CS[C@@H]12)c1noc(N)n1 |
| InChI | InChI=1S/C22H19N7O6S/c1-34-26-14(17-25-22(23)35-27-17)18(30)24-15-19(31)29-16(21(32)33)12(10-36-20(15)29)9-28-8-4-6-11-5-2-3-7-13(11)28/h2-8,15,20H,9-10H2,1H3,(H3-,23,24,25,27,30,32,33)/t15?,20-/m0/s1 |
| InChIKey | IHJGPDRLODEZKV-MBABXSBOSA-N |
| XLogP | -1.45 |
| TPSA | 179.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|