C23H20N6O7S — CID 88734530
(6S)-7-[[2-(2-amino-1,3-oxazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(6-hydroxyquinolin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88734530) has the molecular formula C23H20N6O7S and a molecular weight of 524.52 g/mol. Its IUPAC name is (6S)-7-[[2-(2-amino-1,3-oxazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(6-hydroxyquinolin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6S)-7-[[2-(2-amino-1,3-oxazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(6-hydroxyquinolin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88734530 |
| Molecular Formula | C23H20N6O7S |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | (6S)-7-[[2-(2-amino-1,3-oxazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[(6-hydroxyquinolin-1-ium-1-yl)methyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3cccc4cc(O)ccc43)CS[C@@H]12)c1coc(N)n1 |
| InChI | InChI=1S/C23H20N6O7S/c1-35-27-16(14-9-36-23(24)25-14)19(31)26-17-20(32)29-18(22(33)34)12(10-37-21(17)29)8-28-6-2-3-11-7-13(30)4-5-15(11)28/h2-7,9,17,21H,8,10H2,1H3,(H4-,24,25,26,30,31,33,34)/t17?,21-/m0/s1 |
| InChIKey | OHDDZXDEURZFFL-LFABVHOISA-N |
| XLogP | -1.14 |
| TPSA | 187.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|