C29H32ClNO5 — CID 13231050
[2-chloro-4-formyl-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2S,6S)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl] pyridine-2-carboxylate (PubChem CID 13231050) has the molecular formula C29H32ClNO5 and a molecular weight of 510.03 g/mol. Its IUPAC name is [2-chloro-4-formyl-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2S,6S)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl] pyridine-2-carboxylate.
| Compound Name | [2-chloro-4-formyl-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2S,6S)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 13231050 |
| Molecular Formula | C29H32ClNO5 |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | [2-chloro-4-formyl-5-hydroxy-3-methyl-6-[(2E,4E)-3-methyl-5-[(1R,2S,6S)-1,2,6-trimethyl-3-oxocyclohexyl]penta-2,4-dienyl]phenyl] pyridine-2-carboxylate |
| SMILES | CC(/C=C/[C@]1(C)[C@H](C)C(=O)CC[C@@H]1C)=C\Cc1c(O)c(C=O)c(C)c(Cl)c1OC(=O)c1ccccn1 |
| InChI | InChI=1S/C29H32ClNO5/c1-17(13-14-29(5)18(2)10-12-24(33)20(29)4)9-11-21-26(34)22(16-32)19(3)25(30)27(21)36-28(35)23-8-6-7-15-31-23/h6-9,13-16,18,20,34H,10-12H2,1-5H3/b14-13+,17-9+/t18-,20+,29-/m0/s1 |
| InChIKey | QNKOYQRSQISJMR-RPPHSZQMSA-N |
| XLogP | 6.47 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|