C15H22O6 — CID 13234726
diethyl 3-methyl-6,10-dioxaspiro[4.5]dec-1-ene-4,4-dicarboxylate (PubChem CID 13234726) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is diethyl 3-methyl-6,10-dioxaspiro[4.5]dec-1-ene-4,4-dicarboxylate.
| Compound Name | diethyl 3-methyl-6,10-dioxaspiro[4.5]dec-1-ene-4,4-dicarboxylate |
|---|---|
| PubChem CID | 13234726 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | diethyl 3-methyl-6,10-dioxaspiro[4.5]dec-1-ene-4,4-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C(C)C=CC12OCCCO2 |
| InChI | InChI=1S/C15H22O6/c1-4-18-12(16)15(13(17)19-5-2)11(3)7-8-14(15)20-9-6-10-21-14/h7-8,11H,4-6,9-10H2,1-3H3 |
| InChIKey | YRTXLOKYHRCONS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|