C13H18O7 — CID 13234727
dimethyl 3-methoxy-6,10-dioxaspiro[4.5]dec-1-ene-4,4-dicarboxylate (PubChem CID 13234727) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is dimethyl 3-methoxy-6,10-dioxaspiro[4.5]dec-1-ene-4,4-dicarboxylate.
| Compound Name | dimethyl 3-methoxy-6,10-dioxaspiro[4.5]dec-1-ene-4,4-dicarboxylate |
|---|---|
| PubChem CID | 13234727 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | dimethyl 3-methoxy-6,10-dioxaspiro[4.5]dec-1-ene-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(OC)C=CC12OCCCO2 |
| InChI | InChI=1S/C13H18O7/c1-16-9-5-6-12(19-7-4-8-20-12)13(9,10(14)17-2)11(15)18-3/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | NQBSSVUIFIMESG-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|