C12H16O7 — CID 24973650
dimethyl 8-methoxy-1,4-dioxaspiro[4.4]non-6-ene-9,9-dicarboxylate (PubChem CID 24973650) has the molecular formula C12H16O7 and a molecular weight of 272.25 g/mol. Its IUPAC name is dimethyl 8-methoxy-1,4-dioxaspiro[4.4]non-6-ene-9,9-dicarboxylate.
| Compound Name | dimethyl 8-methoxy-1,4-dioxaspiro[4.4]non-6-ene-9,9-dicarboxylate |
|---|---|
| PubChem CID | 24973650 |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | dimethyl 8-methoxy-1,4-dioxaspiro[4.4]non-6-ene-9,9-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(OC)C=CC12OCCO2 |
| InChI | InChI=1S/C12H16O7/c1-15-8-4-5-11(18-6-7-19-11)12(8,9(13)16-2)10(14)17-3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | OHVKSVBGVYTBBB-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|